C20H26N2O4S — CID 7823267
[2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823267) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823267 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [2-[4-[(2S)-butan-2-yl]anilino]-2-oxoethyl] (3R,7aS)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CC[C@H](C)c1ccc(NC(=O)COC(=O)[C@@H]2CS[C@@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C20H26N2O4S/c1-4-13(2)14-5-7-15(8-6-14)21-17(23)11-26-19(25)16-12-27-20(3)10-9-18(24)22(16)20/h5-8,13,16H,4,9-12H2,1-3H3,(H,21,23)/t13-,16-,20-/m0/s1 |
| InChIKey | MCDHAARADBUWJR-RISOHXOYSA-N |
| XLogP | 3.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |