C19H22N2O6S — CID 7823316
[2-(4-ethoxycarbonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate (PubChem CID 7823316) has the molecular formula C19H22N2O6S and a molecular weight of 406.46 g/mol. Its IUPAC name is [2-(4-ethoxycarbonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate.
| Compound Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
|---|---|
| PubChem CID | 7823316 |
| Molecular Formula | C19H22N2O6S |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | [2-(4-ethoxycarbonylanilino)-2-oxoethyl] (3R,7aR)-7a-methyl-5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)[C@@H]2CS[C@]3(C)CCC(=O)N23)cc1 |
| InChI | InChI=1S/C19H22N2O6S/c1-3-26-17(24)12-4-6-13(7-5-12)20-15(22)10-27-18(25)14-11-28-19(2)9-8-16(23)21(14)19/h4-7,14H,3,8-11H2,1-2H3,(H,20,22)/t14-,19+/m0/s1 |
| InChIKey | IXVFXNVKONVKIE-IFXJQAMLSA-N |
| XLogP | 1.80 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |