C18H23NO4 — CID 111106910
4-[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]-7-methoxychromen-2-one (PubChem CID 111106910) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 4-[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]-7-methoxychromen-2-one.
| Compound Name | 4-[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 111106910 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 4-[[2-(1-hydroxyethyl)piperidin-1-yl]methyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2c(CN3CCCCC3C(C)O)cc(=O)oc2c1 |
| InChI | InChI=1S/C18H23NO4/c1-12(20)16-5-3-4-8-19(16)11-13-9-18(21)23-17-10-14(22-2)6-7-15(13)17/h6-7,9-10,12,16,20H,3-5,8,11H2,1-2H3 |
| InChIKey | JPDJUSGBSQYPHW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|