C19H18ClNO2S — CID 52528933
6-chloro-7-methyl-4-[[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]chromen-2-one (PubChem CID 52528933) has the molecular formula C19H18ClNO2S and a molecular weight of 359.88 g/mol. Its IUPAC name is 6-chloro-7-methyl-4-[[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]chromen-2-one.
| Compound Name | 6-chloro-7-methyl-4-[[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 52528933 |
| Molecular Formula | C19H18ClNO2S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | 6-chloro-7-methyl-4-[[(2S)-2-thiophen-3-ylpyrrolidin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCC[C@H]3c3ccsc3)c2cc1Cl |
| InChI | InChI=1S/C19H18ClNO2S/c1-12-7-18-15(9-16(12)20)14(8-19(22)23-18)10-21-5-2-3-17(21)13-4-6-24-11-13/h4,6-9,11,17H,2-3,5,10H2,1H3/t17-/m0/s1 |
| InChIKey | PHHSEAGGPSWNHS-KRWDZBQOSA-N |
| XLogP | 5.15 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|