C23H22ClNO4 — CID 32732791
6-chloro-4-[[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]-7-methylchromen-2-one (PubChem CID 32732791) has the molecular formula C23H22ClNO4 and a molecular weight of 411.89 g/mol. Its IUPAC name is 6-chloro-4-[[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]-7-methylchromen-2-one.
| Compound Name | 6-chloro-4-[[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]-7-methylchromen-2-one |
|---|---|
| PubChem CID | 32732791 |
| Molecular Formula | C23H22ClNO4 |
| Molecular Weight | 411.89 g/mol |
| Exact Mass | 411.12 |
| IUPAC Name | 6-chloro-4-[[(2R)-2-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidin-1-yl]methyl]-7-methylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCC[C@@H]3c3ccc4c(c3)OCCO4)c2cc1Cl |
| InChI | InChI=1S/C23H22ClNO4/c1-14-9-21-17(12-18(14)24)16(11-23(26)29-21)13-25-6-2-3-19(25)15-4-5-20-22(10-15)28-8-7-27-20/h4-5,9-12,19H,2-3,6-8,13H2,1H3/t19-/m1/s1 |
| InChIKey | HXMYLYIOBQUYMC-LJQANCHMSA-N |
| XLogP | 4.86 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.89 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|