C26H27ClN2O6 — CID 24560524
ethyl 2-(4-chlorophenyl)-2-[4-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]piperazin-1-yl]acetate (PubChem CID 24560524) has the molecular formula C26H27ClN2O6 and a molecular weight of 498.96 g/mol. Its IUPAC name is ethyl 2-(4-chlorophenyl)-2-[4-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-(4-chlorophenyl)-2-[4-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 24560524 |
| Molecular Formula | C26H27ClN2O6 |
| Molecular Weight | 498.96 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | ethyl 2-(4-chlorophenyl)-2-[4-[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]piperazin-1-yl]acetate |
| SMILES | CCOC(=O)C(c1ccc(Cl)cc1)N1CCN(C(=O)COc2ccc3c(C)cc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C26H27ClN2O6/c1-3-33-26(32)25(18-4-6-19(27)7-5-18)29-12-10-28(11-13-29)23(30)16-34-20-8-9-21-17(2)14-24(31)35-22(21)15-20/h4-9,14-15,25H,3,10-13,16H2,1-2H3 |
| InChIKey | GMWIMCSLZZYUIS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.96 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|