C20H23N3O6 — CID 9412266
ethyl 4-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]hydrazinylidene]piperidine-1-carboxylate (PubChem CID 9412266) has the molecular formula C20H23N3O6 and a molecular weight of 401.42 g/mol. Its IUPAC name is ethyl 4-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]hydrazinylidene]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]hydrazinylidene]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 9412266 |
| Molecular Formula | C20H23N3O6 |
| Molecular Weight | 401.42 g/mol |
| Exact Mass | 401.16 |
| IUPAC Name | ethyl 4-[[2-(4-methyl-2-oxochromen-7-yl)oxyacetyl]hydrazinylidene]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(=NNC(=O)COc2ccc3c(C)cc(=O)oc3c2)CC1 |
| InChI | InChI=1S/C20H23N3O6/c1-3-27-20(26)23-8-6-14(7-9-23)21-22-18(24)12-28-15-4-5-16-13(2)10-19(25)29-17(16)11-15/h4-5,10-11H,3,6-9,12H2,1-2H3,(H,22,24) |
| InChIKey | OJNGEFGGHIOGKA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 110.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|