C19H21NO5 — CID 4148985
[2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate (PubChem CID 4148985) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate.
| Compound Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
|---|---|
| PubChem CID | 4148985 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | [2-(2-ethylpiperidin-1-yl)-2-oxoethyl] 4-oxochromene-2-carboxylate |
| SMILES | CCC1CCCCN1C(=O)COC(=O)c1cc(=O)c2ccccc2o1 |
| InChI | InChI=1S/C19H21NO5/c1-2-13-7-5-6-10-20(13)18(22)12-24-19(23)17-11-15(21)14-8-3-4-9-16(14)25-17/h3-4,8-9,11,13H,2,5-7,10,12H2,1H3 |
| InChIKey | XHTWQFOPERHJMX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |