C17H18ClN3O4S2 — CID 42118183
N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-pyridin-2-ylsulfanylacetamide (PubChem CID 42118183) has the molecular formula C17H18ClN3O4S2 and a molecular weight of 427.94 g/mol. Its IUPAC name is N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-pyridin-2-ylsulfanylacetamide.
| Compound Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-pyridin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 42118183 |
| Molecular Formula | C17H18ClN3O4S2 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | N-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-2-pyridin-2-ylsulfanylacetamide |
| SMILES | O=C(CSc1ccccn1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1Cl |
| InChI | InChI=1S/C17H18ClN3O4S2/c18-14-5-4-13(27(23,24)21-7-9-25-10-8-21)11-15(14)20-16(22)12-26-17-3-1-2-6-19-17/h1-6,11H,7-10,12H2,(H,20,22) |
| InChIKey | ZARGVJQQFJDESN-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |