C22H22ClN3O4S2 — CID 46367192
N-(2-chlorophenyl)-2-(4-methyl-6-morpholin-4-ylsulfonylquinolin-2-yl)sulfanylacetamide (PubChem CID 46367192) has the molecular formula C22H22ClN3O4S2 and a molecular weight of 492.02 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-(4-methyl-6-morpholin-4-ylsulfonylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-(4-methyl-6-morpholin-4-ylsulfonylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 46367192 |
| Molecular Formula | C22H22ClN3O4S2 |
| Molecular Weight | 492.02 g/mol |
| Exact Mass | 491.07 |
| IUPAC Name | N-(2-chlorophenyl)-2-(4-methyl-6-morpholin-4-ylsulfonylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)Nc2ccccc2Cl)nc2ccc(S(=O)(=O)N3CCOCC3)cc12 |
| InChI | InChI=1S/C22H22ClN3O4S2/c1-15-12-22(31-14-21(27)24-20-5-3-2-4-18(20)23)25-19-7-6-16(13-17(15)19)32(28,29)26-8-10-30-11-9-26/h2-7,12-13H,8-11,14H2,1H3,(H,24,27) |
| InChIKey | PPGPKAQJUAZRGI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.02 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |