C22H23N3O5S2 — CID 35942255
N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-quinolin-2-ylsulfanylacetamide (PubChem CID 35942255) has the molecular formula C22H23N3O5S2 and a molecular weight of 473.58 g/mol. Its IUPAC name is N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-quinolin-2-ylsulfanylacetamide.
| Compound Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-quinolin-2-ylsulfanylacetamide |
|---|---|
| PubChem CID | 35942255 |
| Molecular Formula | C22H23N3O5S2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | N-(2-methoxy-5-morpholin-4-ylsulfonylphenyl)-2-quinolin-2-ylsulfanylacetamide |
| SMILES | COc1ccc(S(=O)(=O)N2CCOCC2)cc1NC(=O)CSc1ccc2ccccc2n1 |
| InChI | InChI=1S/C22H23N3O5S2/c1-29-20-8-7-17(32(27,28)25-10-12-30-13-11-25)14-19(20)23-21(26)15-31-22-9-6-16-4-2-3-5-18(16)24-22/h2-9,14H,10-13,15H2,1H3,(H,23,26) |
| InChIKey | PMTJNXBKAAXMGX-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 97.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |