C14H12ClFN3O2+ — CID 8854105
1-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide (PubChem CID 8854105) has the molecular formula C14H12ClFN3O2+ and a molecular weight of 308.72 g/mol. Its IUPAC name is 1-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8854105 |
| Molecular Formula | C14H12ClFN3O2+ |
| Molecular Weight | 308.72 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 1-[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
| SMILES | NC(=O)c1ccc[n+](CC(=O)Nc2ccc(F)cc2Cl)c1 |
| InChI | InChI=1S/C14H11ClFN3O2/c15-11-6-10(16)3-4-12(11)18-13(20)8-19-5-1-2-9(7-19)14(17)21/h1-7H,8H2,(H2-,17,18,20,21)/p+1 |
| InChIKey | YHPJKPULUVSOHA-UHFFFAOYSA-O |
| XLogP | 1.50 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.72 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|