C16H17N4O4+ — CID 8831500
1-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide (PubChem CID 8831500) has the molecular formula C16H17N4O4+ and a molecular weight of 329.34 g/mol. Its IUPAC name is 1-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8831500 |
| Molecular Formula | C16H17N4O4+ |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]pyridin-1-ium-3-carboxamide |
| SMILES | Cc1cc(NC(=O)C[n+]2cccc(C(N)=O)c2)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C16H16N4O4/c1-10-6-13(14(20(23)24)7-11(10)2)18-15(21)9-19-5-3-4-12(8-19)16(17)22/h3-8H,9H2,1-2H3,(H2-,17,18,21,22)/p+1 |
| InChIKey | JMTNZHNSILVEFM-UHFFFAOYSA-O |
| XLogP | 1.24 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|