C19H19N4O3+ — CID 8854588
N-(4,5-dimethyl-2-nitrophenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide (PubChem CID 8854588) has the molecular formula C19H19N4O3+ and a molecular weight of 351.39 g/mol. Its IUPAC name is N-(4,5-dimethyl-2-nitrophenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide.
| Compound Name | N-(4,5-dimethyl-2-nitrophenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8854588 |
| Molecular Formula | C19H19N4O3+ |
| Molecular Weight | 351.39 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-(4,5-dimethyl-2-nitrophenyl)-2-(3-ethenylbenzimidazol-1-ium-1-yl)acetamide |
| SMILES | C=Cn1c[n+](CC(=O)Nc2cc(C)c(C)cc2[N+](=O)[O-])c2ccccc21 |
| InChI | InChI=1S/C19H18N4O3/c1-4-21-12-22(17-8-6-5-7-16(17)21)11-19(24)20-15-9-13(2)14(3)10-18(15)23(25)26/h4-10,12H,1,11H2,2-3H3/p+1 |
| InChIKey | JLECTYFEASNYEC-UHFFFAOYSA-O |
| XLogP | 3.19 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|