C19H16N4O6 — CID 4041751
3-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid (PubChem CID 4041751) has the molecular formula C19H16N4O6 and a molecular weight of 396.36 g/mol. Its IUPAC name is 3-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid.
| Compound Name | 3-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 4041751 |
| Molecular Formula | C19H16N4O6 |
| Molecular Weight | 396.36 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | 3-[2-(4,5-dimethyl-2-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid |
| SMILES | Cc1cc(NC(=O)Cn2nc(C(=O)O)c3ccccc3c2=O)c([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C19H16N4O6/c1-10-7-14(15(23(28)29)8-11(10)2)20-16(24)9-22-18(25)13-6-4-3-5-12(13)17(21-22)19(26)27/h3-8H,9H2,1-2H3,(H,20,24)(H,26,27) |
| InChIKey | WRXCSEZJBZUHHH-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|