C18H15N3O6S — CID 16611098
3-[2-(2-methylsulfonylanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid (PubChem CID 16611098) has the molecular formula C18H15N3O6S and a molecular weight of 401.40 g/mol. Its IUPAC name is 3-[2-(2-methylsulfonylanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid.
| Compound Name | 3-[2-(2-methylsulfonylanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 16611098 |
| Molecular Formula | C18H15N3O6S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 3-[2-(2-methylsulfonylanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylic acid |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)Cn1nc(C(=O)O)c2ccccc2c1=O |
| InChI | InChI=1S/C18H15N3O6S/c1-28(26,27)14-9-5-4-8-13(14)19-15(22)10-21-17(23)12-7-3-2-6-11(12)16(20-21)18(24)25/h2-9H,10H2,1H3,(H,19,22)(H,24,25) |
| InChIKey | KBCYJBBPEFYJHE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 135.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |