C17H9Cl4N3O4 — CID 2460473
4-oxo-3-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]phthalazine-1-carboxylic acid (PubChem CID 2460473) has the molecular formula C17H9Cl4N3O4 and a molecular weight of 461.09 g/mol. Its IUPAC name is 4-oxo-3-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]phthalazine-1-carboxylic acid.
| Compound Name | 4-oxo-3-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]phthalazine-1-carboxylic acid |
|---|---|
| PubChem CID | 2460473 |
| Molecular Formula | C17H9Cl4N3O4 |
| Molecular Weight | 461.09 g/mol |
| Exact Mass | 458.93 |
| IUPAC Name | 4-oxo-3-[2-oxo-2-(2,3,5,6-tetrachloroanilino)ethyl]phthalazine-1-carboxylic acid |
| SMILES | O=C(Cn1nc(C(=O)O)c2ccccc2c1=O)Nc1c(Cl)c(Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C17H9Cl4N3O4/c18-9-5-10(19)13(21)15(12(9)20)22-11(25)6-24-16(26)8-4-2-1-3-7(8)14(23-24)17(27)28/h1-5H,6H2,(H,22,25)(H,27,28) |
| InChIKey | ADUBSTAZCOLSFJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.09 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|