C18H13N4O6- — CID 7991707
3-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylate (PubChem CID 7991707) has the molecular formula C18H13N4O6- and a molecular weight of 381.32 g/mol. Its IUPAC name is 3-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylate.
| Compound Name | 3-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7991707 |
| Molecular Formula | C18H13N4O6- |
| Molecular Weight | 381.32 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 3-[2-(2-methyl-6-nitroanilino)-2-oxoethyl]-4-oxophthalazine-1-carboxylate |
| SMILES | Cc1cccc([N+](=O)[O-])c1NC(=O)Cn1nc(C(=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C18H14N4O6/c1-10-5-4-8-13(22(27)28)15(10)19-14(23)9-21-17(24)12-7-3-2-6-11(12)16(20-21)18(25)26/h2-8H,9H2,1H3,(H,19,23)(H,25,26)/p-1 |
| InChIKey | FYCMLHSAHMQZKI-UHFFFAOYSA-M |
| XLogP | 0.62 |
| TPSA | 147.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|