C16H18N3O4- — CID 2689870
4-oxo-3-[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl]phthalazine-1-carboxylate (PubChem CID 2689870) has the molecular formula C16H18N3O4- and a molecular weight of 316.34 g/mol. Its IUPAC name is 4-oxo-3-[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl]phthalazine-1-carboxylate.
| Compound Name | 4-oxo-3-[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl]phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2689870 |
| Molecular Formula | C16H18N3O4- |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | 4-oxo-3-[2-oxo-2-[[(2S)-pentan-2-yl]amino]ethyl]phthalazine-1-carboxylate |
| SMILES | CCC[C@H](C)NC(=O)Cn1nc(C(=O)[O-])c2ccccc2c1=O |
| InChI | InChI=1S/C16H19N3O4/c1-3-6-10(2)17-13(20)9-19-15(21)12-8-5-4-7-11(12)14(18-19)16(22)23/h4-5,7-8,10H,3,6,9H2,1-2H3,(H,17,20)(H,22,23)/p-1/t10-/m0/s1 |
| InChIKey | AMQZFZQYEIHPBP-JTQLQIEISA-M |
| XLogP | 0.06 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |