C18H11F3N3O4- — CID 2379329
4-oxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]phthalazine-1-carboxylate (PubChem CID 2379329) has the molecular formula C18H11F3N3O4- and a molecular weight of 390.30 g/mol. Its IUPAC name is 4-oxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]phthalazine-1-carboxylate.
| Compound Name | 4-oxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2379329 |
| Molecular Formula | C18H11F3N3O4- |
| Molecular Weight | 390.30 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 4-oxo-3-[2-oxo-2-[2-(trifluoromethyl)anilino]ethyl]phthalazine-1-carboxylate |
| SMILES | O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H12F3N3O4/c19-18(20,21)12-7-3-4-8-13(12)22-14(25)9-24-16(26)11-6-2-1-5-10(11)15(23-24)17(27)28/h1-8H,9H2,(H,22,25)(H,27,28)/p-1 |
| InChIKey | WDUJLGHSCXPWBC-UHFFFAOYSA-M |
| XLogP | 1.42 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |