C24H18N3O5- — CID 2387555
4-oxo-3-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]phthalazine-1-carboxylate (PubChem CID 2387555) has the molecular formula C24H18N3O5- and a molecular weight of 428.42 g/mol. Its IUPAC name is 4-oxo-3-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]phthalazine-1-carboxylate.
| Compound Name | 4-oxo-3-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]phthalazine-1-carboxylate |
|---|---|
| PubChem CID | 2387555 |
| Molecular Formula | C24H18N3O5- |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-oxo-3-[2-oxo-2-(4-phenylmethoxyanilino)ethyl]phthalazine-1-carboxylate |
| SMILES | O=C(Cn1nc(C(=O)[O-])c2ccccc2c1=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H19N3O5/c28-21(14-27-23(29)20-9-5-4-8-19(20)22(26-27)24(30)31)25-17-10-12-18(13-11-17)32-15-16-6-2-1-3-7-16/h1-13H,14-15H2,(H,25,28)(H,30,31)/p-1 |
| InChIKey | VJBQFIHAHHORBT-UHFFFAOYSA-M |
| XLogP | 1.98 |
| TPSA | 113.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |