C21H19F3N4O2S — CID 53137099
2-(1-oxo-4-thiomorpholin-4-ylphthalazin-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 53137099) has the molecular formula C21H19F3N4O2S and a molecular weight of 448.47 g/mol. Its IUPAC name is 2-(1-oxo-4-thiomorpholin-4-ylphthalazin-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(1-oxo-4-thiomorpholin-4-ylphthalazin-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 53137099 |
| Molecular Formula | C21H19F3N4O2S |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 2-(1-oxo-4-thiomorpholin-4-ylphthalazin-2-yl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cn1nc(N2CCSCC2)c2ccccc2c1=O)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C21H19F3N4O2S/c22-21(23,24)16-7-3-4-8-17(16)25-18(29)13-28-20(30)15-6-2-1-5-14(15)19(26-28)27-9-11-31-12-10-27/h1-8H,9-13H2,(H,25,29) |
| InChIKey | YFGUOHHLTAMTFU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |