C15H12Cl2FN3O2 — CID 33013992
4-chloro-2-[[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]amino]benzamide (PubChem CID 33013992) has the molecular formula C15H12Cl2FN3O2 and a molecular weight of 356.18 g/mol. Its IUPAC name is 4-chloro-2-[[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]amino]benzamide.
| Compound Name | 4-chloro-2-[[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 33013992 |
| Molecular Formula | C15H12Cl2FN3O2 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 4-chloro-2-[[2-(2-chloro-4-fluoroanilino)-2-oxoethyl]amino]benzamide |
| SMILES | NC(=O)c1ccc(Cl)cc1NCC(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C15H12Cl2FN3O2/c16-8-1-3-10(15(19)23)13(5-8)20-7-14(22)21-12-4-2-9(18)6-11(12)17/h1-6,20H,7H2,(H2,19,23)(H,21,22) |
| InChIKey | PQPZCHBHCNVVIL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |