C21H26ClN3O4S2 — CID 55353506
3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-[(4-ethoxyphenyl)methyl]-1-methylthiourea (PubChem CID 55353506) has the molecular formula C21H26ClN3O4S2 and a molecular weight of 484.04 g/mol. Its IUPAC name is 3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-[(4-ethoxyphenyl)methyl]-1-methylthiourea.
| Compound Name | 3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-[(4-ethoxyphenyl)methyl]-1-methylthiourea |
|---|---|
| PubChem CID | 55353506 |
| Molecular Formula | C21H26ClN3O4S2 |
| Molecular Weight | 484.04 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | 3-(2-chloro-5-morpholin-4-ylsulfonylphenyl)-1-[(4-ethoxyphenyl)methyl]-1-methylthiourea |
| SMILES | CCOc1ccc(CN(C)C(=S)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2Cl)cc1 |
| InChI | InChI=1S/C21H26ClN3O4S2/c1-3-29-17-6-4-16(5-7-17)15-24(2)21(30)23-20-14-18(8-9-19(20)22)31(26,27)25-10-12-28-13-11-25/h4-9,14H,3,10-13,15H2,1-2H3,(H,23,30) |
| InChIKey | KZWRMZLXMDWAMQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.04 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|