C23H28N2O7S — CID 42979506
[2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 42979506) has the molecular formula C23H28N2O7S and a molecular weight of 476.55 g/mol. Its IUPAC name is [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42979506 |
| Molecular Formula | C23H28N2O7S |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | [2-[(4-ethoxyphenyl)methyl-methylamino]-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCOc1ccc(CN(C)C(=O)COC(=O)c2ccc(S(=O)(=O)N3CCOCC3)cc2)cc1 |
| InChI | InChI=1S/C23H28N2O7S/c1-3-31-20-8-4-18(5-9-20)16-24(2)22(26)17-32-23(27)19-6-10-21(11-7-19)33(28,29)25-12-14-30-15-13-25/h4-11H,3,12-17H2,1-2H3 |
| InChIKey | SUDSHYAUBZXQKA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 102.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |