C25H29N3O3 — CID 108848504
butyl 2-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoate (PubChem CID 108848504) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108848504 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-[1-(4-ethylphenyl)ethylamino]-3-oxoprop-1-enyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1N/C=C(/C#N)C(=O)NC(C)c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-4-6-15-31-25(30)22-9-7-8-10-23(22)27-17-21(16-26)24(29)28-18(3)20-13-11-19(5-2)12-14-20/h7-14,17-18,27H,4-6,15H2,1-3H3,(H,28,29)/b21-17- |
| InChIKey | RTJOPIMVZKOZPL-FXBPSFAMSA-N |
| XLogP | 4.90 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|