C21H22N4O3 — CID 108837369
butyl 2-[[(Z)-2-cyano-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]amino]benzoate (PubChem CID 108837369) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is butyl 2-[[(Z)-2-cyano-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]amino]benzoate.
| Compound Name | butyl 2-[[(Z)-2-cyano-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]amino]benzoate |
|---|---|
| PubChem CID | 108837369 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | butyl 2-[[(Z)-2-cyano-3-oxo-3-(pyridin-3-ylmethylamino)prop-1-enyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1N/C=C(/C#N)C(=O)NCc1cccnc1 |
| InChI | InChI=1S/C21H22N4O3/c1-2-3-11-28-21(27)18-8-4-5-9-19(18)24-15-17(12-22)20(26)25-14-16-7-6-10-23-13-16/h4-10,13,15,24H,2-3,11,14H2,1H3,(H,25,26)/b17-15- |
| InChIKey | NUQCUUXOVGQOJL-ICFOKQHNSA-N |
| XLogP | 3.17 |
| TPSA | 104.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|