C24H29N3O — CID 108848637
(Z)-3-(2-tert-butylanilino)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide (PubChem CID 108848637) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is (Z)-3-(2-tert-butylanilino)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide.
| Compound Name | (Z)-3-(2-tert-butylanilino)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 108848637 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | (Z)-3-(2-tert-butylanilino)-2-cyano-N-[1-(4-ethylphenyl)ethyl]prop-2-enamide |
| SMILES | CCc1ccc(C(C)NC(=O)/C(C#N)=C\Nc2ccccc2C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-6-18-11-13-19(14-12-18)17(2)27-23(28)20(15-25)16-26-22-10-8-7-9-21(22)24(3,4)5/h7-14,16-17,26H,6H2,1-5H3,(H,27,28)/b20-16- |
| InChIKey | FZHXSCRTSWRZHS-SILNSSARSA-N |
| XLogP | 5.24 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|