C10H15N3O3 — CID 108834366
2-[[(Z)-3-(butan-2-ylamino)-2-cyano-3-oxoprop-1-enyl]amino]acetic acid (PubChem CID 108834366) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-[[(Z)-3-(butan-2-ylamino)-2-cyano-3-oxoprop-1-enyl]amino]acetic acid.
| Compound Name | 2-[[(Z)-3-(butan-2-ylamino)-2-cyano-3-oxoprop-1-enyl]amino]acetic acid |
|---|---|
| PubChem CID | 108834366 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 2-[[(Z)-3-(butan-2-ylamino)-2-cyano-3-oxoprop-1-enyl]amino]acetic acid |
| SMILES | CCC(C)NC(=O)/C(C#N)=C\NCC(=O)O |
| InChI | InChI=1S/C10H15N3O3/c1-3-7(2)13-10(16)8(4-11)5-12-6-9(14)15/h5,7,12H,3,6H2,1-2H3,(H,13,16)(H,14,15)/b8-5- |
| InChIKey | ABCQJZFCOPUFNB-YVMONPNESA-N |
| XLogP | -0.02 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|