C10H14N6O3 — CID 108844530
(Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide (PubChem CID 108844530) has the molecular formula C10H14N6O3 and a molecular weight of 266.26 g/mol. Its IUPAC name is (Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108844530 |
| Molecular Formula | C10H14N6O3 |
| Molecular Weight | 266.26 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ncn[nH]1)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C10H14N6O3/c11-5-8(6-12-10-13-7-14-15-10)9(19)16(1-3-17)2-4-18/h6-7,17-18H,1-4H2,(H2,12,13,14,15)/b8-6- |
| InChIKey | AGWYRIUXSHSGAZ-VURMDHGXSA-N |
| XLogP | -1.56 |
| TPSA | 138.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.26 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|