C11H15N7O — CID 108862002
(Z)-2-(4-methylpiperazine-1-carbonyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enenitrile (PubChem CID 108862002) has the molecular formula C11H15N7O and a molecular weight of 261.29 g/mol. Its IUPAC name is (Z)-2-(4-methylpiperazine-1-carbonyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-methylpiperazine-1-carbonyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108862002 |
| Molecular Formula | C11H15N7O |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | (Z)-2-(4-methylpiperazine-1-carbonyl)-3-(1H-1,2,4-triazol-5-ylamino)prop-2-enenitrile |
| SMILES | CN1CCN(C(=O)/C(C#N)=C\Nc2ncn[nH]2)CC1 |
| InChI | InChI=1S/C11H15N7O/c1-17-2-4-18(5-3-17)10(19)9(6-12)7-13-11-14-8-15-16-11/h7-8H,2-5H2,1H3,(H2,13,14,15,16)/b9-7- |
| InChIKey | LMFKBSNIMXADIP-CLFYSBASSA-N |
| XLogP | -0.60 |
| TPSA | 100.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|