C14H16FN3O3 — CID 108844443
(Z)-2-cyano-3-(2-fluoroanilino)-N,N-bis(2-hydroxyethyl)prop-2-enamide (PubChem CID 108844443) has the molecular formula C14H16FN3O3 and a molecular weight of 293.30 g/mol. Its IUPAC name is (Z)-2-cyano-3-(2-fluoroanilino)-N,N-bis(2-hydroxyethyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(2-fluoroanilino)-N,N-bis(2-hydroxyethyl)prop-2-enamide |
|---|---|
| PubChem CID | 108844443 |
| Molecular Formula | C14H16FN3O3 |
| Molecular Weight | 293.30 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | (Z)-2-cyano-3-(2-fluoroanilino)-N,N-bis(2-hydroxyethyl)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccccc1F)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C14H16FN3O3/c15-12-3-1-2-4-13(12)17-10-11(9-16)14(21)18(5-7-19)6-8-20/h1-4,10,17,19-20H,5-8H2/b11-10- |
| InChIKey | FZQJGLWIJGCJSY-KHPPLWFESA-N |
| XLogP | 0.46 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.30 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|