C15H18IN3O3 — CID 108844412
(Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(4-iodo-2-methylanilino)prop-2-enamide (PubChem CID 108844412) has the molecular formula C15H18IN3O3 and a molecular weight of 415.23 g/mol. Its IUPAC name is (Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(4-iodo-2-methylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(4-iodo-2-methylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108844412 |
| Molecular Formula | C15H18IN3O3 |
| Molecular Weight | 415.23 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | (Z)-2-cyano-N,N-bis(2-hydroxyethyl)-3-(4-iodo-2-methylanilino)prop-2-enamide |
| SMILES | Cc1cc(I)ccc1N/C=C(/C#N)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C15H18IN3O3/c1-11-8-13(16)2-3-14(11)18-10-12(9-17)15(22)19(4-6-20)5-7-21/h2-3,8,10,18,20-21H,4-7H2,1H3/b12-10- |
| InChIKey | PSQDKNOARUFGDJ-BENRWUELSA-N |
| XLogP | 1.23 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|