C17H18IN3O — CID 108861138
(Z)-2-cyano-3-(4-iodo-2-methylanilino)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 108861138) has the molecular formula C17H18IN3O and a molecular weight of 407.26 g/mol. Its IUPAC name is (Z)-2-cyano-3-(4-iodo-2-methylanilino)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(4-iodo-2-methylanilino)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 108861138 |
| Molecular Formula | C17H18IN3O |
| Molecular Weight | 407.26 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (Z)-2-cyano-3-(4-iodo-2-methylanilino)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\Nc1ccc(I)cc1C |
| InChI | InChI=1S/C17H18IN3O/c1-4-8-21(9-5-2)17(22)14(11-19)12-20-16-7-6-15(18)10-13(16)3/h4-7,10,12,20H,1-2,8-9H2,3H3/b14-12- |
| InChIKey | MHYYTEDEJDMIHK-OWBHPGMISA-N |
| XLogP | 3.62 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.26 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|