About (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide
(Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 108861275) has the molecular formula C16H15Cl2N3O
and a molecular weight of 336.22 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide.
Molecular Properties
| Compound Name | (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide |
| PubChem CID | 108861275 |
| Molecular Formula | C16H15Cl2N3O |
| Molecular Weight | 336.22 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2N3O/c1-3-5-21(6-4-2)16(22)12(10-19)11-20-15-8-13(17)7-14(18)9-15/h3-4,7-9,11,20H,1-2,5-6H2/b12-11- |
| InChIKey | BHQYDNXJHKRTKA-QXMHVHEDSA-N |
| XLogP | 4.01 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide?
The IUPAC name of (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide (CID 108861275) is (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide.
What is the SMILES notation for (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide?
The canonical SMILES for (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide is C=CCN(CC=C)C(=O)/C(C#N)=C\Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide?
The InChIKey is BHQYDNXJHKRTKA-QXMHVHEDSA-N. The full InChI is InChI=1S/C16H15Cl2N3O/c1-3-5-21(6-4-2)16(22)12(10-19)11-20-15-8-13(17)7-14(18)9-15/h3-4,7-9,11,20H,1-2,5-6H2/b12-11-.
What are the key properties of (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide?
(Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide has a molecular weight of 336.22 g/mol, XLogP of 4.01, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-cyano-3-(3,5-dichloroanilino)-N,N-bis(prop-2-enyl)prop-2-enamide is sourced from PubChem (CID 108861275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).