C10H7Cl2N3S — CID 20787420
(Z)-2-cyano-3-(3,5-dichloroanilino)prop-2-enethioamide (PubChem CID 20787420) has the molecular formula C10H7Cl2N3S and a molecular weight of 272.16 g/mol. Its IUPAC name is (Z)-2-cyano-3-(3,5-dichloroanilino)prop-2-enethioamide.
| Compound Name | (Z)-2-cyano-3-(3,5-dichloroanilino)prop-2-enethioamide |
|---|---|
| PubChem CID | 20787420 |
| Molecular Formula | C10H7Cl2N3S |
| Molecular Weight | 272.16 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | (Z)-2-cyano-3-(3,5-dichloroanilino)prop-2-enethioamide |
| SMILES | N#C/C(=C/Nc1cc(Cl)cc(Cl)c1)C(N)=S |
| InChI | InChI=1S/C10H7Cl2N3S/c11-7-1-8(12)3-9(2-7)15-5-6(4-13)10(14)16/h1-3,5,15H,(H2,14,16)/b6-5- |
| InChIKey | MLZRYAATYZOGQM-WAYWQWQTSA-N |
| XLogP | 3.10 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.16 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|