C9H8Cl2N2O — CID 134372586
(Z)-3-(3,5-dichloroanilino)prop-2-enamide (PubChem CID 134372586) has the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. Its IUPAC name is (Z)-3-(3,5-dichloroanilino)prop-2-enamide.
| Compound Name | (Z)-3-(3,5-dichloroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 134372586 |
| Molecular Formula | C9H8Cl2N2O |
| Molecular Weight | 231.08 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | (Z)-3-(3,5-dichloroanilino)prop-2-enamide |
| SMILES | NC(=O)/C=C\Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C9H8Cl2N2O/c10-6-3-7(11)5-8(4-6)13-2-1-9(12)14/h1-5,13H,(H2,12,14)/b2-1- |
| InChIKey | KKEWBUASUYZNHY-UPHRSURJSA-N |
| XLogP | 2.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.08 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|