C10H8BrN3S — CID 18529386
(Z)-3-(4-bromoanilino)-2-cyanoprop-2-enethioamide (PubChem CID 18529386) has the molecular formula C10H8BrN3S and a molecular weight of 282.17 g/mol. Its IUPAC name is (Z)-3-(4-bromoanilino)-2-cyanoprop-2-enethioamide.
| Compound Name | (Z)-3-(4-bromoanilino)-2-cyanoprop-2-enethioamide |
|---|---|
| PubChem CID | 18529386 |
| Molecular Formula | C10H8BrN3S |
| Molecular Weight | 282.17 g/mol |
| Exact Mass | 280.96 |
| IUPAC Name | (Z)-3-(4-bromoanilino)-2-cyanoprop-2-enethioamide |
| SMILES | N#C/C(=C/Nc1ccc(Br)cc1)C(N)=S |
| InChI | InChI=1S/C10H8BrN3S/c11-8-1-3-9(4-2-8)14-6-7(5-12)10(13)15/h1-4,6,14H,(H2,13,15)/b7-6- |
| InChIKey | CNXXLNUQKWTJFW-SREVYHEPSA-N |
| XLogP | 2.55 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.17 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|