C12H12Cl2N2O2S — CID 134100279
(E)-3-(3,5-dichloroanilino)-2-propan-2-ylsulfonylprop-2-enenitrile (PubChem CID 134100279) has the molecular formula C12H12Cl2N2O2S and a molecular weight of 319.21 g/mol. Its IUPAC name is (E)-3-(3,5-dichloroanilino)-2-propan-2-ylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-dichloroanilino)-2-propan-2-ylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 134100279 |
| Molecular Formula | C12H12Cl2N2O2S |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 318.00 |
| IUPAC Name | (E)-3-(3,5-dichloroanilino)-2-propan-2-ylsulfonylprop-2-enenitrile |
| SMILES | CC(C)S(=O)(=O)/C(C#N)=C/Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O2S/c1-8(2)19(17,18)12(6-15)7-16-11-4-9(13)3-10(14)5-11/h3-5,7-8,16H,1-2H3/b12-7+ |
| InChIKey | HPOZBBJPEFIMKC-KPKJPENVSA-N |
| XLogP | 3.59 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|