C14H16Cl2N2O2S — CID 134100261
(E)-3-(3,5-dichloro-N-ethylanilino)-2-propan-2-ylsulfonylprop-2-enenitrile (PubChem CID 134100261) has the molecular formula C14H16Cl2N2O2S and a molecular weight of 347.27 g/mol. Its IUPAC name is (E)-3-(3,5-dichloro-N-ethylanilino)-2-propan-2-ylsulfonylprop-2-enenitrile.
| Compound Name | (E)-3-(3,5-dichloro-N-ethylanilino)-2-propan-2-ylsulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 134100261 |
| Molecular Formula | C14H16Cl2N2O2S |
| Molecular Weight | 347.27 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | (E)-3-(3,5-dichloro-N-ethylanilino)-2-propan-2-ylsulfonylprop-2-enenitrile |
| SMILES | CCN(/C=C(\C#N)S(=O)(=O)C(C)C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2O2S/c1-4-18(13-6-11(15)5-12(16)7-13)9-14(8-17)21(19,20)10(2)3/h5-7,9-10H,4H2,1-3H3/b14-9+ |
| InChIKey | YPMTWJIIJSKKBC-NTEUORMPSA-N |
| XLogP | 4.01 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.27 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|