C13H19N3O — CID 108861031
(Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(propylamino)prop-2-enamide (PubChem CID 108861031) has the molecular formula C13H19N3O and a molecular weight of 233.31 g/mol. Its IUPAC name is (Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(propylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(propylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108861031 |
| Molecular Formula | C13H19N3O |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.15 |
| IUPAC Name | (Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(propylamino)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\NCCC |
| InChI | InChI=1S/C13H19N3O/c1-4-7-15-11-12(10-14)13(17)16(8-5-2)9-6-3/h5-6,11,15H,2-4,7-9H2,1H3/b12-11- |
| InChIKey | PHKVRDQKIVZKOJ-QXMHVHEDSA-N |
| XLogP | 1.59 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|