C16H25N3O — CID 108861281
(Z)-3-[tert-butyl(ethyl)amino]-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 108861281) has the molecular formula C16H25N3O and a molecular weight of 275.40 g/mol. Its IUPAC name is (Z)-3-[tert-butyl(ethyl)amino]-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (Z)-3-[tert-butyl(ethyl)amino]-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 108861281 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (Z)-3-[tert-butyl(ethyl)amino]-2-cyano-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\N(CC)C(C)(C)C |
| InChI | InChI=1S/C16H25N3O/c1-7-10-18(11-8-2)15(20)14(12-17)13-19(9-3)16(4,5)6/h7-8,13H,1-2,9-11H2,3-6H3/b14-13- |
| InChIKey | KFIYWTCRKYYFQI-YPKPFQOOSA-N |
| XLogP | 2.71 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|