C15H23N3O — CID 108861176
(Z)-2-cyano-3-(pentylamino)-N,N-bis(prop-2-enyl)prop-2-enamide (PubChem CID 108861176) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is (Z)-2-cyano-3-(pentylamino)-N,N-bis(prop-2-enyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(pentylamino)-N,N-bis(prop-2-enyl)prop-2-enamide |
|---|---|
| PubChem CID | 108861176 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | (Z)-2-cyano-3-(pentylamino)-N,N-bis(prop-2-enyl)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\NCCCCC |
| InChI | InChI=1S/C15H23N3O/c1-4-7-8-9-17-13-14(12-16)15(19)18(10-5-2)11-6-3/h5-6,13,17H,2-4,7-11H2,1H3/b14-13- |
| InChIKey | FGZOJLUCYJUBPL-YPKPFQOOSA-N |
| XLogP | 2.37 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|