C14H15N5O — CID 108861168
(Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108861168) has the molecular formula C14H15N5O and a molecular weight of 269.31 g/mol. Its IUPAC name is (Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108861168 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (Z)-2-cyano-N,N-bis(prop-2-enyl)-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | C=CCN(CC=C)C(=O)/C(C#N)=C\Nc1ncccn1 |
| InChI | InChI=1S/C14H15N5O/c1-3-8-19(9-4-2)13(20)12(10-15)11-18-14-16-6-5-7-17-14/h3-7,11H,1-2,8-9H2,(H,16,17,18)/b12-11- |
| InChIKey | LMOYXFNSOIWRDF-QXMHVHEDSA-N |
| XLogP | 1.50 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|