C16H14N6O2 — CID 108818586
(Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide (PubChem CID 108818586) has the molecular formula C16H14N6O2 and a molecular weight of 322.33 g/mol. Its IUPAC name is (Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108818586 |
| Molecular Formula | C16H14N6O2 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | (Z)-N-acetyl-N-(4-aminophenyl)-2-cyano-3-(pyrimidin-2-ylamino)prop-2-enamide |
| SMILES | CC(=O)N(C(=O)/C(C#N)=C\Nc1ncccn1)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H14N6O2/c1-11(23)22(14-5-3-13(18)4-6-14)15(24)12(9-17)10-21-16-19-7-2-8-20-16/h2-8,10H,18H2,1H3,(H,19,20,21)/b12-10- |
| InChIKey | XLYSJEOOHATDSI-BENRWUELSA-N |
| XLogP | 1.46 |
| TPSA | 125.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|