C16H18N4O4 — CID 108818450
4-[[(Z)-3-(N-acetyl-4-aminoanilino)-2-cyano-3-oxoprop-1-enyl]amino]butanoic acid (PubChem CID 108818450) has the molecular formula C16H18N4O4 and a molecular weight of 330.34 g/mol. Its IUPAC name is 4-[[(Z)-3-(N-acetyl-4-aminoanilino)-2-cyano-3-oxoprop-1-enyl]amino]butanoic acid.
| Compound Name | 4-[[(Z)-3-(N-acetyl-4-aminoanilino)-2-cyano-3-oxoprop-1-enyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108818450 |
| Molecular Formula | C16H18N4O4 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-[[(Z)-3-(N-acetyl-4-aminoanilino)-2-cyano-3-oxoprop-1-enyl]amino]butanoic acid |
| SMILES | CC(=O)N(C(=O)/C(C#N)=C\NCCCC(=O)O)c1ccc(N)cc1 |
| InChI | InChI=1S/C16H18N4O4/c1-11(21)20(14-6-4-13(18)5-7-14)16(24)12(9-17)10-19-8-2-3-15(22)23/h4-7,10,19H,2-3,8,18H2,1H3,(H,22,23)/b12-10- |
| InChIKey | AUCHNCVYQULVLC-BENRWUELSA-N |
| XLogP | 1.01 |
| TPSA | 136.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|