C19H17ClN4O2 — CID 108818956
(Z)-N-acetyl-N-(4-aminophenyl)-3-[(3-chlorophenyl)methylamino]-2-cyanoprop-2-enamide (PubChem CID 108818956) has the molecular formula C19H17ClN4O2 and a molecular weight of 368.82 g/mol. Its IUPAC name is (Z)-N-acetyl-N-(4-aminophenyl)-3-[(3-chlorophenyl)methylamino]-2-cyanoprop-2-enamide.
| Compound Name | (Z)-N-acetyl-N-(4-aminophenyl)-3-[(3-chlorophenyl)methylamino]-2-cyanoprop-2-enamide |
|---|---|
| PubChem CID | 108818956 |
| Molecular Formula | C19H17ClN4O2 |
| Molecular Weight | 368.82 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | (Z)-N-acetyl-N-(4-aminophenyl)-3-[(3-chlorophenyl)methylamino]-2-cyanoprop-2-enamide |
| SMILES | CC(=O)N(C(=O)/C(C#N)=C\NCc1cccc(Cl)c1)c1ccc(N)cc1 |
| InChI | InChI=1S/C19H17ClN4O2/c1-13(25)24(18-7-5-17(22)6-8-18)19(26)15(10-21)12-23-11-14-3-2-4-16(20)9-14/h2-9,12,23H,11,22H2,1H3/b15-12- |
| InChIKey | PGSVEPUXPHGJRS-QINSGFPZSA-N |
| XLogP | 3.00 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_K(2)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|