C22H14Cl2N2S — CID 126198149
2-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-1,3-benzothiazole (PubChem CID 126198149) has the molecular formula C22H14Cl2N2S and a molecular weight of 409.34 g/mol. Its IUPAC name is 2-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-1,3-benzothiazole.
| Compound Name | 2-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 126198149 |
| Molecular Formula | C22H14Cl2N2S |
| Molecular Weight | 409.34 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 2-[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]-1,3-benzothiazole |
| SMILES | Clc1ccc(Cn2cc(-c3nc4ccccc4s3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C22H14Cl2N2S/c23-15-10-9-14(18(24)11-15)12-26-13-17(16-5-1-3-7-20(16)26)22-25-19-6-2-4-8-21(19)27-22/h1-11,13H,12H2 |
| InChIKey | QJRPPHIYCLEFSI-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.34 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |