C25H16Cl4N4S — CID 123398743
[1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]diazene (PubChem CID 123398743) has the molecular formula C25H16Cl4N4S and a molecular weight of 546.31 g/mol. Its IUPAC name is [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]diazene.
| Compound Name | [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]diazene |
|---|---|
| PubChem CID | 123398743 |
| Molecular Formula | C25H16Cl4N4S |
| Molecular Weight | 546.31 g/mol |
| Exact Mass | 543.98 |
| IUPAC Name | [1-[(2,4-dichlorophenyl)methyl]indol-3-yl]methyl-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]diazene |
| SMILES | Clc1ccc(Cn2cc(C/N=N/c3nc(-c4ccc(Cl)cc4Cl)cs3)c3ccccc32)c(Cl)c1 |
| InChI | InChI=1S/C25H16Cl4N4S/c26-17-6-5-15(21(28)9-17)12-33-13-16(19-3-1-2-4-24(19)33)11-30-32-25-31-23(14-34-25)20-8-7-18(27)10-22(20)29/h1-10,13-14H,11-12H2/b32-30+ |
| InChIKey | GOXVLELWPAYOED-NHQGMKOOSA-N |
| XLogP | 9.71 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.31 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|