C26H22N4S — CID 123340275
1-(1-benzylindol-3-yl)ethyl-(4-phenyl-1,3-thiazol-2-yl)diazene (PubChem CID 123340275) has the molecular formula C26H22N4S and a molecular weight of 422.56 g/mol. Its IUPAC name is 1-(1-benzylindol-3-yl)ethyl-(4-phenyl-1,3-thiazol-2-yl)diazene.
| Compound Name | 1-(1-benzylindol-3-yl)ethyl-(4-phenyl-1,3-thiazol-2-yl)diazene |
|---|---|
| PubChem CID | 123340275 |
| Molecular Formula | C26H22N4S |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 1-(1-benzylindol-3-yl)ethyl-(4-phenyl-1,3-thiazol-2-yl)diazene |
| SMILES | CC(/N=N/c1nc(-c2ccccc2)cs1)c1cn(Cc2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C26H22N4S/c1-19(28-29-26-27-24(18-31-26)21-12-6-3-7-13-21)23-17-30(16-20-10-4-2-5-11-20)25-15-9-8-14-22(23)25/h2-15,17-19H,16H2,1H3/b29-28+ |
| InChIKey | NWBKALOGXPXDST-ZQHSETAFSA-N |
| XLogP | 7.66 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|